Pentaerythritol Tetrahexanoate (C09-1013-217)

Pentaerythritol tetrahexanoate (PEH) is a synthetic ester derived from pentaerythritol, a polyol compound. It presents as a white, waxy solid that demonstrates water insolubility and possesses a melting point around 90° C. The versatility of PEH renders it valuable in various applications, serving as a plasticizer, lubricant, and surfactant. Additionally, it finds utility as an intermediate compound in the synthesis of other compounds. Within the realm of scientific research, Pentaerythritol tetrahexanoate has garnered attention and investigation in multiple applications. Its potential as a plasticizer for polymers, a lubricant for reducing friction between surfaces, and a surfactant for minimizing liquid surface tension has been thoroughly explored. Moreover, its role as an intermediate in the synthesis of diverse compounds adds to its significance in the scientific community. Specification: 0.96 Molecular Formula: C29H52O8 Molecular Weight: 528.72 PubChem CID: 4652589 Isomeric SMILES: CCCCCC(=O)OCC(COC(=O)CCCCC)(COC(=O)CCCCC)COC(=O)CCCCC Related Documents: https://ald-pub-files.oss-cn-shanghai.aliyuncs.com/aladdinsci/pdp/sds/1/P338927-SCI_7fc31a8482de90198d2e4a2a4d6a96a2.pdf